C7H7ClF4O2 — CID 88759861
2-(2,2,3,3-tetrafluorocyclobutyl)prop-2-enoic acid;hydrochloride (PubChem CID 88759861) has the molecular formula C7H7ClF4O2 and a molecular weight of 234.58 g/mol. Its IUPAC name is 2-(2,2,3,3-tetrafluorocyclobutyl)prop-2-enoic acid;hydrochloride.
| Compound Name | 2-(2,2,3,3-tetrafluorocyclobutyl)prop-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 88759861 |
| Molecular Formula | C7H7ClF4O2 |
| Molecular Weight | 234.58 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 2-(2,2,3,3-tetrafluorocyclobutyl)prop-2-enoic acid;hydrochloride |
| SMILES | C=C(C(=O)O)C1CC(F)(F)C1(F)F.Cl |
| InChI | InChI=1S/C7H6F4O2.ClH/c1-3(5(12)13)4-2-6(8,9)7(4,10)11;/h4H,1-2H2,(H,12,13);1H |
| InChIKey | SGTCEUZPXAPHJW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.58 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|