C5H3F4O2- — CID 74420491
2,2,3,3-tetrafluorocyclobutane-1-carboxylate (PubChem CID 74420491) has the molecular formula C5H3F4O2- and a molecular weight of 171.07 g/mol. Its IUPAC name is 2,2,3,3-tetrafluorocyclobutane-1-carboxylate.
| Compound Name | 2,2,3,3-tetrafluorocyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 74420491 |
| Molecular Formula | C5H3F4O2- |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 171.01 |
| IUPAC Name | 2,2,3,3-tetrafluorocyclobutane-1-carboxylate |
| SMILES | O=C([O-])C1CC(F)(F)C1(F)F |
| InChI | InChI=1S/C5H4F4O2/c6-4(7)1-2(3(10)11)5(4,8)9/h2H,1H2,(H,10,11)/p-1 |
| InChIKey | YPIGSOZDUWOJQG-UHFFFAOYSA-M |
| XLogP | 0.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|