(1R)-2,2-difluorocyclopropane-1-carbonyl chloride

C4H3ClF2O — CID 124563920

IUPAC(1R)-2,2-difluorocyclopropane-1-carbonyl chloride
SMILESO=C(Cl)[C@@H]1CC1(F)F
InChIInChI=1S/C4H3ClF2O/c5-3(8)2-1-4(2,6)7/h2H,1H2/t2-/m0/s1
InChIKeyARDXUROAPJDKCZ-REOHCLBHSA-N
MW140.52 g/mol
LogP1.41
Rot. Bonds1

About (1R)-2,2-difluorocyclopropane-1-carbonyl chloride

(1R)-2,2-difluorocyclopropane-1-carbonyl chloride (PubChem CID 124563920) has the molecular formula C4H3ClF2O and a molecular weight of 140.52 g/mol. Its IUPAC name is (1R)-2,2-difluorocyclopropane-1-carbonyl chloride.

Molecular Properties

Compound Name(1R)-2,2-difluorocyclopropane-1-carbonyl chloride
PubChem CID124563920
Molecular FormulaC4H3ClF2O
Molecular Weight140.52 g/mol
Exact Mass139.98
IUPAC Name(1R)-2,2-difluorocyclopropane-1-carbonyl chloride
SMILESO=C(Cl)[C@@H]1CC1(F)F
InChIInChI=1S/C4H3ClF2O/c5-3(8)2-1-4(2,6)7/h2H,1H2/t2-/m0/s1
InChIKeyARDXUROAPJDKCZ-REOHCLBHSA-N
XLogP1.41
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500140.52
LogP ≤ 51.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (1R)-2,2-difluorocyclopropane-1-carbonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R)-2,2-difluorocyclopropane-1-carbonyl chloride?
The IUPAC name of (1R)-2,2-difluorocyclopropane-1-carbonyl chloride (CID 124563920) is (1R)-2,2-difluorocyclopropane-1-carbonyl chloride.
What is the SMILES notation for (1R)-2,2-difluorocyclopropane-1-carbonyl chloride?
The canonical SMILES for (1R)-2,2-difluorocyclopropane-1-carbonyl chloride is O=C(Cl)[C@@H]1CC1(F)F.
What is the InChIKey of (1R)-2,2-difluorocyclopropane-1-carbonyl chloride?
The InChIKey is ARDXUROAPJDKCZ-REOHCLBHSA-N. The full InChI is InChI=1S/C4H3ClF2O/c5-3(8)2-1-4(2,6)7/h2H,1H2/t2-/m0/s1.
What are the key properties of (1R)-2,2-difluorocyclopropane-1-carbonyl chloride?
(1R)-2,2-difluorocyclopropane-1-carbonyl chloride has a molecular weight of 140.52 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2-difluorocyclopropane-1-carbonyl chloride is sourced from PubChem (CID 124563920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).