About (1R)-2,2-difluorocyclopropane-1-carbohydrazide
(1R)-2,2-difluorocyclopropane-1-carbohydrazide (PubChem CID 134522612) has the molecular formula C4H6F2N2O
and a molecular weight of 136.10 g/mol. Its IUPAC name is (1R)-2,2-difluorocyclopropane-1-carbohydrazide.
Molecular Properties
| Compound Name | (1R)-2,2-difluorocyclopropane-1-carbohydrazide |
| PubChem CID | 134522612 |
| Molecular Formula | C4H6F2N2O |
| Molecular Weight | 136.10 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | (1R)-2,2-difluorocyclopropane-1-carbohydrazide |
| SMILES | NNC(=O)[C@H]1CC1(F)F |
| InChI | InChI=1S/C4H6F2N2O/c5-4(6)1-2(4)3(9)8-7/h2H,1,7H2,(H,8,9)/t2-/m1/s1 |
| InChIKey | QJZCKHZKHGBZRV-UWTATZPHSA-N |
| XLogP | -0.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.10 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2,2-difluorocyclopropane-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2,2-difluorocyclopropane-1-carbohydrazide?
The IUPAC name of (1R)-2,2-difluorocyclopropane-1-carbohydrazide (CID 134522612) is (1R)-2,2-difluorocyclopropane-1-carbohydrazide.
What is the SMILES notation for (1R)-2,2-difluorocyclopropane-1-carbohydrazide?
The canonical SMILES for (1R)-2,2-difluorocyclopropane-1-carbohydrazide is NNC(=O)[C@H]1CC1(F)F.
What is the InChIKey of (1R)-2,2-difluorocyclopropane-1-carbohydrazide?
The InChIKey is QJZCKHZKHGBZRV-UWTATZPHSA-N. The full InChI is InChI=1S/C4H6F2N2O/c5-4(6)1-2(4)3(9)8-7/h2H,1,7H2,(H,8,9)/t2-/m1/s1.
What are the key properties of (1R)-2,2-difluorocyclopropane-1-carbohydrazide?
(1R)-2,2-difluorocyclopropane-1-carbohydrazide has a molecular weight of 136.10 g/mol, XLogP of -0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2,2-difluorocyclopropane-1-carbohydrazide is sourced from PubChem (CID 134522612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).