C11H15F2NO — CID 129348680
(1S)-2,2-difluoro-N-[(1R)-1-methylcyclohex-3-en-1-yl]cyclopropane-1-carboxamide (PubChem CID 129348680) has the molecular formula C11H15F2NO and a molecular weight of 215.24 g/mol. Its IUPAC name is (1S)-2,2-difluoro-N-[(1R)-1-methylcyclohex-3-en-1-yl]cyclopropane-1-carboxamide.
| Compound Name | (1S)-2,2-difluoro-N-[(1R)-1-methylcyclohex-3-en-1-yl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 129348680 |
| Molecular Formula | C11H15F2NO |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | (1S)-2,2-difluoro-N-[(1R)-1-methylcyclohex-3-en-1-yl]cyclopropane-1-carboxamide |
| SMILES | C[C@]1(NC(=O)[C@@H]2CC2(F)F)CC=CCC1 |
| InChI | InChI=1S/C11H15F2NO/c1-10(5-3-2-4-6-10)14-9(15)8-7-11(8,12)13/h2-3,8H,4-7H2,1H3,(H,14,15)/t8-,10-/m0/s1 |
| InChIKey | KHHOWVUWJWDENE-WPRPVWTQSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|