C12H18N4O — CID 128670697
N-(1-methylcyclohex-3-en-1-yl)-3-(triazol-1-yl)propanamide (PubChem CID 128670697) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is N-(1-methylcyclohex-3-en-1-yl)-3-(triazol-1-yl)propanamide.
| Compound Name | N-(1-methylcyclohex-3-en-1-yl)-3-(triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 128670697 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | N-(1-methylcyclohex-3-en-1-yl)-3-(triazol-1-yl)propanamide |
| SMILES | CC1(NC(=O)CCn2ccnn2)CC=CCC1 |
| InChI | InChI=1S/C12H18N4O/c1-12(6-3-2-4-7-12)14-11(17)5-9-16-10-8-13-15-16/h2-3,8,10H,4-7,9H2,1H3,(H,14,17) |
| InChIKey | JQRIHYCWAJUZPZ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|