C10H16N4O3 — CID 115427037
2,2-dimethyl-3-[3-(triazol-1-yl)propanoylamino]propanoic acid (PubChem CID 115427037) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 2,2-dimethyl-3-[3-(triazol-1-yl)propanoylamino]propanoic acid.
| Compound Name | 2,2-dimethyl-3-[3-(triazol-1-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 115427037 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 2,2-dimethyl-3-[3-(triazol-1-yl)propanoylamino]propanoic acid |
| SMILES | CC(C)(CNC(=O)CCn1ccnn1)C(=O)O |
| InChI | InChI=1S/C10H16N4O3/c1-10(2,9(16)17)7-11-8(15)3-5-14-6-4-12-13-14/h4,6H,3,5,7H2,1-2H3,(H,11,15)(H,16,17) |
| InChIKey | BFEBDCNZMXIBDB-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |