C6H3O6-3 — CID 6923149
(2R)-cyclopropane-1,1,2-tricarboxylate (PubChem CID 6923149) has the molecular formula C6H3O6-3 and a molecular weight of 171.08 g/mol. Its IUPAC name is (2R)-cyclopropane-1,1,2-tricarboxylate.
| Compound Name | (2R)-cyclopropane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 6923149 |
| Molecular Formula | C6H3O6-3 |
| Molecular Weight | 171.08 g/mol |
| Exact Mass | 170.99 |
| IUPAC Name | (2R)-cyclopropane-1,1,2-tricarboxylate |
| SMILES | O=C([O-])[C@@H]1CC1(C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C6H6O6/c7-3(8)2-1-6(2,4(9)10)5(11)12/h2H,1H2,(H,7,8)(H,9,10)(H,11,12)/p-3/t2-/m0/s1 |
| InChIKey | YKXAGRCDGMWYRO-REOHCLBHSA-K |
| XLogP | -4.76 |
| TPSA | 120.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.08 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|