C6H7F2NO3 — CID 131153136
2-[(3,3-difluorocyclobutyl)amino]-2-oxoacetic acid (PubChem CID 131153136) has the molecular formula C6H7F2NO3 and a molecular weight of 179.12 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclobutyl)amino]-2-oxoacetic acid.
| Compound Name | 2-[(3,3-difluorocyclobutyl)amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 131153136 |
| Molecular Formula | C6H7F2NO3 |
| Molecular Weight | 179.12 g/mol |
| Exact Mass | 179.04 |
| IUPAC Name | 2-[(3,3-difluorocyclobutyl)amino]-2-oxoacetic acid |
| SMILES | O=C(O)C(=O)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C6H7F2NO3/c7-6(8)1-3(2-6)9-4(10)5(11)12/h3H,1-2H2,(H,9,10)(H,11,12) |
| InChIKey | YFLMXGXZHGVUIK-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.12 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|