C9H14F2N2O — CID 130609514
1-cyclopropyl-3-(3,3-difluorocyclopentyl)urea (PubChem CID 130609514) has the molecular formula C9H14F2N2O and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-cyclopropyl-3-(3,3-difluorocyclopentyl)urea.
| Compound Name | 1-cyclopropyl-3-(3,3-difluorocyclopentyl)urea |
|---|---|
| PubChem CID | 130609514 |
| Molecular Formula | C9H14F2N2O |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 1-cyclopropyl-3-(3,3-difluorocyclopentyl)urea |
| SMILES | O=C(NC1CC1)NC1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H14F2N2O/c10-9(11)4-3-7(5-9)13-8(14)12-6-1-2-6/h6-7H,1-5H2,(H2,12,13,14) |
| InChIKey | QCJOPKHINJOBIQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |