C8H11F3N2O — CID 106211177
1-cyclopropyl-3-[1-(trifluoromethyl)cyclopropyl]urea (PubChem CID 106211177) has the molecular formula C8H11F3N2O and a molecular weight of 208.18 g/mol. Its IUPAC name is 1-cyclopropyl-3-[1-(trifluoromethyl)cyclopropyl]urea.
| Compound Name | 1-cyclopropyl-3-[1-(trifluoromethyl)cyclopropyl]urea |
|---|---|
| PubChem CID | 106211177 |
| Molecular Formula | C8H11F3N2O |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 1-cyclopropyl-3-[1-(trifluoromethyl)cyclopropyl]urea |
| SMILES | O=C(NC1CC1)NC1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H11F3N2O/c9-8(10,11)7(3-4-7)13-6(14)12-5-1-2-5/h5H,1-4H2,(H2,12,13,14) |
| InChIKey | VTDDNRFMIRQFKR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |