C10H15F3N2O3 — CID 114159452
2-methyl-2-[[1-(trifluoromethyl)cyclopropyl]carbamoylamino]butanoic acid (PubChem CID 114159452) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is 2-methyl-2-[[1-(trifluoromethyl)cyclopropyl]carbamoylamino]butanoic acid.
| Compound Name | 2-methyl-2-[[1-(trifluoromethyl)cyclopropyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 114159452 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 2-methyl-2-[[1-(trifluoromethyl)cyclopropyl]carbamoylamino]butanoic acid |
| SMILES | CCC(C)(NC(=O)NC1(C(F)(F)F)CC1)C(=O)O |
| InChI | InChI=1S/C10H15F3N2O3/c1-3-8(2,6(16)17)14-7(18)15-9(4-5-9)10(11,12)13/h3-5H2,1-2H3,(H,16,17)(H2,14,15,18) |
| InChIKey | YSUCZZUAMUTHKA-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |