C8H13F3N2O3 — CID 16782299
2-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid (PubChem CID 16782299) has the molecular formula C8H13F3N2O3 and a molecular weight of 242.20 g/mol. Its IUPAC name is 2-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid.
| Compound Name | 2-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 16782299 |
| Molecular Formula | C8H13F3N2O3 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-methyl-2-(2,2,2-trifluoroethylcarbamoylamino)butanoic acid |
| SMILES | CCC(C)(NC(=O)NCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H13F3N2O3/c1-3-7(2,5(14)15)13-6(16)12-4-8(9,10)11/h3-4H2,1-2H3,(H,14,15)(H2,12,13,16) |
| InChIKey | KYRKPJVDJJWWJS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |