C15H23F2NO2 — CID 58356090
N-(4-acetylcyclohexyl)-4,4-difluorocyclohexane-1-carboxamide (PubChem CID 58356090) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is N-(4-acetylcyclohexyl)-4,4-difluorocyclohexane-1-carboxamide.
| Compound Name | N-(4-acetylcyclohexyl)-4,4-difluorocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 58356090 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-(4-acetylcyclohexyl)-4,4-difluorocyclohexane-1-carboxamide |
| SMILES | CC(=O)C1CCC(NC(=O)C2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C15H23F2NO2/c1-10(19)11-2-4-13(5-3-11)18-14(20)12-6-8-15(16,17)9-7-12/h11-13H,2-9H2,1H3,(H,18,20) |
| InChIKey | YFODQONXQQKLEW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |