C16H29NO — CID 141160516
N-(4,4-dimethylcyclohexyl)-4-methylcyclohexane-1-carboxamide (PubChem CID 141160516) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is N-(4,4-dimethylcyclohexyl)-4-methylcyclohexane-1-carboxamide.
| Compound Name | N-(4,4-dimethylcyclohexyl)-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 141160516 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | N-(4,4-dimethylcyclohexyl)-4-methylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(=O)NC2CCC(C)(C)CC2)CC1 |
| InChI | InChI=1S/C16H29NO/c1-12-4-6-13(7-5-12)15(18)17-14-8-10-16(2,3)11-9-14/h12-14H,4-11H2,1-3H3,(H,17,18) |
| InChIKey | BJPZIDZHULCPKM-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |