C18H33NO — CID 114550438
4-butyl-N-(3,3-dimethylcyclopentyl)cyclohexane-1-carboxamide (PubChem CID 114550438) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is 4-butyl-N-(3,3-dimethylcyclopentyl)cyclohexane-1-carboxamide.
| Compound Name | 4-butyl-N-(3,3-dimethylcyclopentyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114550438 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | 4-butyl-N-(3,3-dimethylcyclopentyl)cyclohexane-1-carboxamide |
| SMILES | CCCCC1CCC(C(=O)NC2CCC(C)(C)C2)CC1 |
| InChI | InChI=1S/C18H33NO/c1-4-5-6-14-7-9-15(10-8-14)17(20)19-16-11-12-18(2,3)13-16/h14-16H,4-13H2,1-3H3,(H,19,20) |
| InChIKey | JBCVYCIWWJJPDL-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |