C11H20BrNO — CID 114544484
2-bromo-N-(3,3-dimethylcyclopentyl)butanamide (PubChem CID 114544484) has the molecular formula C11H20BrNO and a molecular weight of 262.19 g/mol. Its IUPAC name is 2-bromo-N-(3,3-dimethylcyclopentyl)butanamide.
| Compound Name | 2-bromo-N-(3,3-dimethylcyclopentyl)butanamide |
|---|---|
| PubChem CID | 114544484 |
| Molecular Formula | C11H20BrNO |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-bromo-N-(3,3-dimethylcyclopentyl)butanamide |
| SMILES | CCC(Br)C(=O)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C11H20BrNO/c1-4-9(12)10(14)13-8-5-6-11(2,3)7-8/h8-9H,4-7H2,1-3H3,(H,13,14) |
| InChIKey | AILITRCJVKWSBE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|