C13H22N2O — CID 114546516
2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide (PubChem CID 114546516) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide.
| Compound Name | 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide |
|---|---|
| PubChem CID | 114546516 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide |
| SMILES | CCCC(C#N)C(=O)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C13H22N2O/c1-4-5-10(9-14)12(16)15-11-6-7-13(2,3)8-11/h10-11H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | GSBHECYEJFNOPA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |