About 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide
2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide (PubChem CID 114546516) has the molecular formula C13H22N2O
and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide.
Molecular Properties
| Compound Name | 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide |
| PubChem CID | 114546516 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide |
| SMILES | CCCC(C#N)C(=O)NC1CCC(C)(C)C1 |
| InChI | InChI=1S/C13H22N2O/c1-4-5-10(9-14)12(16)15-11-6-7-13(2,3)8-11/h10-11H,4-8H2,1-3H3,(H,15,16) |
| InChIKey | GSBHECYEJFNOPA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide?
The IUPAC name of 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide (CID 114546516) is 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide.
What is the SMILES notation for 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide?
The canonical SMILES for 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide is CCCC(C#N)C(=O)NC1CCC(C)(C)C1.
What is the InChIKey of 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide?
The InChIKey is GSBHECYEJFNOPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O/c1-4-5-10(9-14)12(16)15-11-6-7-13(2,3)8-11/h10-11H,4-8H2,1-3H3,(H,15,16).
What are the key properties of 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide?
2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide has a molecular weight of 222.33 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-N-(3,3-dimethylcyclopentyl)pentanamide is sourced from PubChem (CID 114546516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).