C14H25NO — CID 112568442
N-(3,3,5,5-tetramethylcyclohexyl)cyclopropanecarboxamide (PubChem CID 112568442) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is N-(3,3,5,5-tetramethylcyclohexyl)cyclopropanecarboxamide.
| Compound Name | N-(3,3,5,5-tetramethylcyclohexyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 112568442 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | N-(3,3,5,5-tetramethylcyclohexyl)cyclopropanecarboxamide |
| SMILES | CC1(C)CC(NC(=O)C2CC2)CC(C)(C)C1 |
| InChI | InChI=1S/C14H25NO/c1-13(2)7-11(8-14(3,4)9-13)15-12(16)10-5-6-10/h10-11H,5-9H2,1-4H3,(H,15,16) |
| InChIKey | IGOUMSADXDSRNQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |