C15H30N2O — CID 113359647
2-(propylamino)-N-(3,3,5,5-tetramethylcyclohexyl)acetamide (PubChem CID 113359647) has the molecular formula C15H30N2O and a molecular weight of 254.42 g/mol. Its IUPAC name is 2-(propylamino)-N-(3,3,5,5-tetramethylcyclohexyl)acetamide.
| Compound Name | 2-(propylamino)-N-(3,3,5,5-tetramethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 113359647 |
| Molecular Formula | C15H30N2O |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.24 |
| IUPAC Name | 2-(propylamino)-N-(3,3,5,5-tetramethylcyclohexyl)acetamide |
| SMILES | CCCNCC(=O)NC1CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C15H30N2O/c1-6-7-16-10-13(18)17-12-8-14(2,3)11-15(4,5)9-12/h12,16H,6-11H2,1-5H3,(H,17,18) |
| InChIKey | TYNJKBQMZPSYEW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|