C18H34N2O — CID 103968408
2-(2-aminocyclohexyl)-N-(3,3,5,5-tetramethylcyclohexyl)acetamide (PubChem CID 103968408) has the molecular formula C18H34N2O and a molecular weight of 294.48 g/mol. Its IUPAC name is 2-(2-aminocyclohexyl)-N-(3,3,5,5-tetramethylcyclohexyl)acetamide.
| Compound Name | 2-(2-aminocyclohexyl)-N-(3,3,5,5-tetramethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 103968408 |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.48 g/mol |
| Exact Mass | 294.27 |
| IUPAC Name | 2-(2-aminocyclohexyl)-N-(3,3,5,5-tetramethylcyclohexyl)acetamide |
| SMILES | CC1(C)CC(NC(=O)CC2CCCCC2N)CC(C)(C)C1 |
| InChI | InChI=1S/C18H34N2O/c1-17(2)10-14(11-18(3,4)12-17)20-16(21)9-13-7-5-6-8-15(13)19/h13-15H,5-12,19H2,1-4H3,(H,20,21) |
| InChIKey | HLWYCYKSMQYVOH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |