C23H36N2O2 — CID 128713974
cis-(1S,3R)-1-N,3-N-di(spiro[2.5]octan-6-yl)cyclopentane-1,3-dicarboxamide (PubChem CID 128713974) has the molecular formula C23H36N2O2 and a molecular weight of 372.55 g/mol. Its IUPAC name is cis-(1S,3R)-1-N,3-N-di(spiro[2.5]octan-6-yl)cyclopentane-1,3-dicarboxamide.
| Compound Name | cis-(1S,3R)-1-N,3-N-di(spiro[2.5]octan-6-yl)cyclopentane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 128713974 |
| Molecular Formula | C23H36N2O2 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | cis-(1S,3R)-1-N,3-N-di(spiro[2.5]octan-6-yl)cyclopentane-1,3-dicarboxamide |
| SMILES | O=C(NC1CCC2(CC1)CC2)[C@@H]1CC[C@H](C(=O)NC2CCC3(CC2)CC3)C1 |
| InChI | InChI=1S/C23H36N2O2/c26-20(24-18-3-7-22(8-4-18)11-12-22)16-1-2-17(15-16)21(27)25-19-5-9-23(10-6-19)13-14-23/h16-19H,1-15H2,(H,24,26)(H,25,27)/t16-,17+ |
| InChIKey | VRAWERRLFNUNEW-CALCHBBNSA-N |
| XLogP | 4.08 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |