C40H64N2O10 — CID 140517688
4-O-[4-[4-[[4-[(4-acetylcyclohexanecarbonyl)amino]cyclohexyl]carbamoyl]cyclohexanecarbonyl]oxybutyl] 1-O-(4-methoxybutyl) cyclohexane-1,4-dicarboxylate (PubChem CID 140517688) has the molecular formula C40H64N2O10 and a molecular weight of 732.96 g/mol. Its IUPAC name is 4-O-[4-[4-[[4-[(4-acetylcyclohexanecarbonyl)amino]cyclohexyl]carbamoyl]cyclohexanecarbonyl]oxybutyl] 1-O-(4-methoxybutyl) cyclohexane-1,4-dicarboxylate.
| Compound Name | 4-O-[4-[4-[[4-[(4-acetylcyclohexanecarbonyl)amino]cyclohexyl]carbamoyl]cyclohexanecarbonyl]oxybutyl] 1-O-(4-methoxybutyl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 140517688 |
| Molecular Formula | C40H64N2O10 |
| Molecular Weight | 732.96 g/mol |
| Exact Mass | 732.46 |
| IUPAC Name | 4-O-[4-[4-[[4-[(4-acetylcyclohexanecarbonyl)amino]cyclohexyl]carbamoyl]cyclohexanecarbonyl]oxybutyl] 1-O-(4-methoxybutyl) cyclohexane-1,4-dicarboxylate |
| SMILES | COCCCCOC(=O)C1CCC(C(=O)OCCCCOC(=O)C2CCC(C(=O)NC3CCC(NC(=O)C4CCC(C(C)=O)CC4)CC3)CC2)CC1 |
| InChI | InChI=1S/C40H64N2O10/c1-27(43)28-7-9-29(10-8-28)36(44)41-34-19-21-35(22-20-34)42-37(45)30-11-13-31(14-12-30)38(46)51-25-5-6-26-52-40(48)33-17-15-32(16-18-33)39(47)50-24-4-3-23-49-2/h28-35H,3-26H2,1-2H3,(H,41,44)(H,42,45) |
| InChIKey | PFJHAGWPYVRQMJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.96 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|