C22H39NO2 — CID 122679814
4-acetyl-N-(4-tert-butyl-4-propan-2-ylcyclohexyl)cyclohexane-1-carboxamide (PubChem CID 122679814) has the molecular formula C22H39NO2 and a molecular weight of 349.56 g/mol. Its IUPAC name is 4-acetyl-N-(4-tert-butyl-4-propan-2-ylcyclohexyl)cyclohexane-1-carboxamide.
| Compound Name | 4-acetyl-N-(4-tert-butyl-4-propan-2-ylcyclohexyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 122679814 |
| Molecular Formula | C22H39NO2 |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.30 |
| IUPAC Name | 4-acetyl-N-(4-tert-butyl-4-propan-2-ylcyclohexyl)cyclohexane-1-carboxamide |
| SMILES | CC(=O)C1CCC(C(=O)NC2CCC(C(C)C)(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C22H39NO2/c1-15(2)22(21(4,5)6)13-11-19(12-14-22)23-20(25)18-9-7-17(8-10-18)16(3)24/h15,17-19H,7-14H2,1-6H3,(H,23,25) |
| InChIKey | RBLXNPRWQKDUTG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |