C21H38N2O — CID 130230324
(4-tert-butyl-4-propan-2-ylcyclohexyl)-(4-prop-1-en-2-ylpiperazin-1-yl)methanone (PubChem CID 130230324) has the molecular formula C21H38N2O and a molecular weight of 334.55 g/mol. Its IUPAC name is (4-tert-butyl-4-propan-2-ylcyclohexyl)-(4-prop-1-en-2-ylpiperazin-1-yl)methanone.
| Compound Name | (4-tert-butyl-4-propan-2-ylcyclohexyl)-(4-prop-1-en-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 130230324 |
| Molecular Formula | C21H38N2O |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.30 |
| IUPAC Name | (4-tert-butyl-4-propan-2-ylcyclohexyl)-(4-prop-1-en-2-ylpiperazin-1-yl)methanone |
| SMILES | C=C(C)N1CCN(C(=O)C2CCC(C(C)C)(C(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C21H38N2O/c1-16(2)21(20(5,6)7)10-8-18(9-11-21)19(24)23-14-12-22(13-15-23)17(3)4/h16,18H,3,8-15H2,1-2,4-7H3 |
| InChIKey | JFCPRGVSGUMFLE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |