C14H24N2O2 — CID 122675582
4-(2,2-dimethylpropanoyl)-1-prop-1-en-2-ylpiperidine-4-carboxamide (PubChem CID 122675582) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-(2,2-dimethylpropanoyl)-1-prop-1-en-2-ylpiperidine-4-carboxamide.
| Compound Name | 4-(2,2-dimethylpropanoyl)-1-prop-1-en-2-ylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 122675582 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 4-(2,2-dimethylpropanoyl)-1-prop-1-en-2-ylpiperidine-4-carboxamide |
| SMILES | C=C(C)N1CCC(C(N)=O)(C(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C14H24N2O2/c1-10(2)16-8-6-14(7-9-16,12(15)18)11(17)13(3,4)5/h1,6-9H2,2-5H3,(H2,15,18) |
| InChIKey | CMVPWJDDRGUEPI-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|