C11H17F2NO2 — CID 121194076
N-(4,4-difluorocyclohexyl)oxolane-3-carboxamide (PubChem CID 121194076) has the molecular formula C11H17F2NO2 and a molecular weight of 233.26 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)oxolane-3-carboxamide.
| Compound Name | N-(4,4-difluorocyclohexyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 121194076 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)oxolane-3-carboxamide |
| SMILES | O=C(NC1CCC(F)(F)CC1)C1CCOC1 |
| InChI | InChI=1S/C11H17F2NO2/c12-11(13)4-1-9(2-5-11)14-10(15)8-3-6-16-7-8/h8-9H,1-7H2,(H,14,15) |
| InChIKey | WSAVGRDXPCNTAB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |