C11H17F2NO2 — CID 174623149
2-[(3,3-difluorocyclopentyl)amino]ethyl cyclopropanecarboxylate (PubChem CID 174623149) has the molecular formula C11H17F2NO2 and a molecular weight of 233.26 g/mol. Its IUPAC name is 2-[(3,3-difluorocyclopentyl)amino]ethyl cyclopropanecarboxylate.
| Compound Name | 2-[(3,3-difluorocyclopentyl)amino]ethyl cyclopropanecarboxylate |
|---|---|
| PubChem CID | 174623149 |
| Molecular Formula | C11H17F2NO2 |
| Molecular Weight | 233.26 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-[(3,3-difluorocyclopentyl)amino]ethyl cyclopropanecarboxylate |
| SMILES | O=C(OCCNC1CCC(F)(F)C1)C1CC1 |
| InChI | InChI=1S/C11H17F2NO2/c12-11(13)4-3-9(7-11)14-5-6-16-10(15)8-1-2-8/h8-9,14H,1-7H2 |
| InChIKey | NNLBEDBWHYAHDX-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|