C8H8F4S — CID 21245995
2,3,5,6-tetrafluoro-3,4-dimethylcyclohexa-1,5-diene-1-thiol (PubChem CID 21245995) has the molecular formula C8H8F4S and a molecular weight of 212.21 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-3,4-dimethylcyclohexa-1,5-diene-1-thiol.
| Compound Name | 2,3,5,6-tetrafluoro-3,4-dimethylcyclohexa-1,5-diene-1-thiol |
|---|---|
| PubChem CID | 21245995 |
| Molecular Formula | C8H8F4S |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 2,3,5,6-tetrafluoro-3,4-dimethylcyclohexa-1,5-diene-1-thiol |
| SMILES | CC1C(F)=C(F)C(S)=C(F)C1(C)F |
| InChI | InChI=1S/C8H8F4S/c1-3-4(9)5(10)6(13)7(11)8(3,2)12/h3,13H,1-2H3 |
| InChIKey | RDKGHUQFSBGONN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|