C8H9F2NO2 — CID 163941629
1,5-difluoro-5,6-dimethyl-4-nitrocyclohexa-1,3-diene (PubChem CID 163941629) has the molecular formula C8H9F2NO2 and a molecular weight of 189.16 g/mol. Its IUPAC name is 1,5-difluoro-5,6-dimethyl-4-nitrocyclohexa-1,3-diene.
| Compound Name | 1,5-difluoro-5,6-dimethyl-4-nitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 163941629 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 1,5-difluoro-5,6-dimethyl-4-nitrocyclohexa-1,3-diene |
| SMILES | CC1C(F)=CC=C([N+](=O)[O-])C1(C)F |
| InChI | InChI=1S/C8H9F2NO2/c1-5-6(9)3-4-7(11(12)13)8(5,2)10/h3-5H,1-2H3 |
| InChIKey | RRMHJODXKKQSMZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|