C7H8FNO2 — CID 166468180
2-fluoro-1-methyl-3-nitrocyclohexa-1,3-diene (PubChem CID 166468180) has the molecular formula C7H8FNO2 and a molecular weight of 157.14 g/mol. Its IUPAC name is 2-fluoro-1-methyl-3-nitrocyclohexa-1,3-diene.
| Compound Name | 2-fluoro-1-methyl-3-nitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 166468180 |
| Molecular Formula | C7H8FNO2 |
| Molecular Weight | 157.14 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | 2-fluoro-1-methyl-3-nitrocyclohexa-1,3-diene |
| SMILES | CC1=C(F)C([N+](=O)[O-])=CCC1 |
| InChI | InChI=1S/C7H8FNO2/c1-5-3-2-4-6(7(5)8)9(10)11/h4H,2-3H2,1H3 |
| InChIKey | CSGFJIPIFJPNJF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.14 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|