About ethane;1-nitrocyclohexene
ethane;1-nitrocyclohexene (PubChem CID 123419787) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is ethane;1-nitrocyclohexene.
Molecular Properties
| Compound Name | ethane;1-nitrocyclohexene |
| PubChem CID | 123419787 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | ethane;1-nitrocyclohexene |
| SMILES | CC.O=[N+]([O-])C1=CCCCC1 |
| InChI | InChI=1S/C6H9NO2.C2H6/c8-7(9)6-4-2-1-3-5-6;1-2/h4H,1-3,5H2;1-2H3 |
| InChIKey | ULLMZKCQTLLNBJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-nitrocyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-nitrocyclohexene?
The IUPAC name of ethane;1-nitrocyclohexene (CID 123419787) is ethane;1-nitrocyclohexene.
What is the SMILES notation for ethane;1-nitrocyclohexene?
The canonical SMILES for ethane;1-nitrocyclohexene is CC.O=[N+]([O-])C1=CCCCC1.
What is the InChIKey of ethane;1-nitrocyclohexene?
The InChIKey is ULLMZKCQTLLNBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.C2H6/c8-7(9)6-4-2-1-3-5-6;1-2/h4H,1-3,5H2;1-2H3.
What are the key properties of ethane;1-nitrocyclohexene?
ethane;1-nitrocyclohexene has a molecular weight of 157.21 g/mol, XLogP of 2.75, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-nitrocyclohexene is sourced from PubChem (CID 123419787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).