C15H20N2O3S — CID 70864078
N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-5-nitrobenzenesulfinamide (PubChem CID 70864078) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-5-nitrobenzenesulfinamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-5-nitrobenzenesulfinamide |
|---|---|
| PubChem CID | 70864078 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2-methyl-5-nitrobenzenesulfinamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1S(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C15H20N2O3S/c1-12-7-8-14(17(18)19)11-15(12)21(20)16-10-9-13-5-3-2-4-6-13/h5,7-8,11,16H,2-4,6,9-10H2,1H3 |
| InChIKey | QXGUEFXJBODFMI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|