C14H15N3O3 — CID 106177617
N-[2-(cyclopenten-1-yl)ethyl]-6-nitro-1,3-benzoxazol-2-amine (PubChem CID 106177617) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is N-[2-(cyclopenten-1-yl)ethyl]-6-nitro-1,3-benzoxazol-2-amine.
| Compound Name | N-[2-(cyclopenten-1-yl)ethyl]-6-nitro-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 106177617 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | N-[2-(cyclopenten-1-yl)ethyl]-6-nitro-1,3-benzoxazol-2-amine |
| SMILES | O=[N+]([O-])c1ccc2nc(NCCC3=CCCC3)oc2c1 |
| InChI | InChI=1S/C14H15N3O3/c18-17(19)11-5-6-12-13(9-11)20-14(16-12)15-8-7-10-3-1-2-4-10/h3,5-6,9H,1-2,4,7-8H2,(H,15,16) |
| InChIKey | IWZWTKRMLKQQAT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|