About 1,2-dimethyl-4-nitrocyclohexa-1,4-diene
1,2-dimethyl-4-nitrocyclohexa-1,4-diene (PubChem CID 11378611) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 1,2-dimethyl-4-nitrocyclohexa-1,4-diene.
Molecular Properties
| Compound Name | 1,2-dimethyl-4-nitrocyclohexa-1,4-diene |
| PubChem CID | 11378611 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1,2-dimethyl-4-nitrocyclohexa-1,4-diene |
| SMILES | CC1=C(C)CC([N+](=O)[O-])=CC1 |
| InChI | InChI=1S/C8H11NO2/c1-6-3-4-8(9(10)11)5-7(6)2/h4H,3,5H2,1-2H3 |
| InChIKey | TXQQOUZIYJCZLI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethyl-4-nitrocyclohexa-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-4-nitrocyclohexa-1,4-diene?
The IUPAC name of 1,2-dimethyl-4-nitrocyclohexa-1,4-diene (CID 11378611) is 1,2-dimethyl-4-nitrocyclohexa-1,4-diene.
What is the SMILES notation for 1,2-dimethyl-4-nitrocyclohexa-1,4-diene?
The canonical SMILES for 1,2-dimethyl-4-nitrocyclohexa-1,4-diene is CC1=C(C)CC([N+](=O)[O-])=CC1.
What is the InChIKey of 1,2-dimethyl-4-nitrocyclohexa-1,4-diene?
The InChIKey is TXQQOUZIYJCZLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-6-3-4-8(9(10)11)5-7(6)2/h4H,3,5H2,1-2H3.
What are the key properties of 1,2-dimethyl-4-nitrocyclohexa-1,4-diene?
1,2-dimethyl-4-nitrocyclohexa-1,4-diene has a molecular weight of 153.18 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-4-nitrocyclohexa-1,4-diene is sourced from PubChem (CID 11378611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).