C7H8ClNO2 — CID 142966788
2-chloro-1-methyl-4-nitrocyclohexa-1,3-diene (PubChem CID 142966788) has the molecular formula C7H8ClNO2 and a molecular weight of 173.60 g/mol. Its IUPAC name is 2-chloro-1-methyl-4-nitrocyclohexa-1,3-diene.
| Compound Name | 2-chloro-1-methyl-4-nitrocyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142966788 |
| Molecular Formula | C7H8ClNO2 |
| Molecular Weight | 173.60 g/mol |
| Exact Mass | 173.02 |
| IUPAC Name | 2-chloro-1-methyl-4-nitrocyclohexa-1,3-diene |
| SMILES | CC1=C(Cl)C=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C7H8ClNO2/c1-5-2-3-6(9(10)11)4-7(5)8/h4H,2-3H2,1H3 |
| InChIKey | NRFDSYLRVRLALV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|