C7H8N2O4 — CID 143426427
2-amino-5-nitrocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 143426427) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-amino-5-nitrocyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 2-amino-5-nitrocyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 143426427 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-amino-5-nitrocyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | NC1=C(C(=O)O)C=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C7H8N2O4/c8-6-2-1-4(9(12)13)3-5(6)7(10)11/h3H,1-2,8H2,(H,10,11) |
| InChIKey | LDPUAMSLEJHNCU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|