C10H11ClN2O6 — CID 142882477
2-chloro-3,6-dinitrocyclohepta-1,3,6-triene-1-carboxylic acid;ethane (PubChem CID 142882477) has the molecular formula C10H11ClN2O6 and a molecular weight of 290.66 g/mol. Its IUPAC name is 2-chloro-3,6-dinitrocyclohepta-1,3,6-triene-1-carboxylic acid;ethane.
| Compound Name | 2-chloro-3,6-dinitrocyclohepta-1,3,6-triene-1-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142882477 |
| Molecular Formula | C10H11ClN2O6 |
| Molecular Weight | 290.66 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 2-chloro-3,6-dinitrocyclohepta-1,3,6-triene-1-carboxylic acid;ethane |
| SMILES | CC.O=C(O)C1=C(Cl)C([N+](=O)[O-])=CCC([N+](=O)[O-])=C1 |
| InChI | InChI=1S/C8H5ClN2O6.C2H6/c9-7-5(8(12)13)3-4(10(14)15)1-2-6(7)11(16)17;1-2/h2-3H,1H2,(H,12,13);1-2H3 |
| InChIKey | VJNOYHWJZSUJJG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.66 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|