C20H12Cl4N2O3 — CID 150679132
3-[(4-chlorophenyl)methylidene]-6-nitro-N-(3,4,5-trichlorophenyl)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 150679132) has the molecular formula C20H12Cl4N2O3 and a molecular weight of 470.14 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylidene]-6-nitro-N-(3,4,5-trichlorophenyl)cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | 3-[(4-chlorophenyl)methylidene]-6-nitro-N-(3,4,5-trichlorophenyl)cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 150679132 |
| Molecular Formula | C20H12Cl4N2O3 |
| Molecular Weight | 470.14 g/mol |
| Exact Mass | 467.96 |
| IUPAC Name | 3-[(4-chlorophenyl)methylidene]-6-nitro-N-(3,4,5-trichlorophenyl)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)c(Cl)c1)C1=CC(=Cc2ccc(Cl)cc2)CC=C1[N+](=O)[O-] |
| InChI | InChI=1S/C20H12Cl4N2O3/c21-13-4-1-11(2-5-13)7-12-3-6-18(26(28)29)15(8-12)20(27)25-14-9-16(22)19(24)17(23)10-14/h1-2,4-10H,3H2,(H,25,27) |
| InChIKey | JHMPREHBWONKGF-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.14 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|