C15H10Cl3NO2 — CID 82880971
(E)-3-(4-chlorophenyl)-N-(3,5-dichloro-4-hydroxyphenyl)prop-2-enamide (PubChem CID 82880971) has the molecular formula C15H10Cl3NO2 and a molecular weight of 342.61 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(3,5-dichloro-4-hydroxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(3,5-dichloro-4-hydroxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 82880971 |
| Molecular Formula | C15H10Cl3NO2 |
| Molecular Weight | 342.61 g/mol |
| Exact Mass | 340.98 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(3,5-dichloro-4-hydroxyphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1)Nc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl3NO2/c16-10-4-1-9(2-5-10)3-6-14(20)19-11-7-12(17)15(21)13(18)8-11/h1-8,21H,(H,19,20)/b6-3+ |
| InChIKey | YKTLMFUVVFSENG-ZZXKWVIFSA-N |
| XLogP | 5.00 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|