C17H15ClINO — CID 17274650
(E)-3-(4-chlorophenyl)-N-(4-iodo-3,5-dimethylphenyl)prop-2-enamide (PubChem CID 17274650) has the molecular formula C17H15ClINO and a molecular weight of 411.67 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-(4-iodo-3,5-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-(4-iodo-3,5-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17274650 |
| Molecular Formula | C17H15ClINO |
| Molecular Weight | 411.67 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-(4-iodo-3,5-dimethylphenyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)/C=C/c2ccc(Cl)cc2)cc(C)c1I |
| InChI | InChI=1S/C17H15ClINO/c1-11-9-15(10-12(2)17(11)19)20-16(21)8-5-13-3-6-14(18)7-4-13/h3-10H,1-2H3,(H,20,21)/b8-5+ |
| InChIKey | ADQFAANOYRDSEB-VMPITWQZSA-N |
| XLogP | 5.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|