About N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine
N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine (PubChem CID 163868016) has the molecular formula C7H9N3O4
and a molecular weight of 199.17 g/mol. Its IUPAC name is N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine |
| PubChem CID | 163868016 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine |
| SMILES | CNC1=C([N+](=O)[O-])C=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C7H9N3O4/c1-8-6-3-2-5(9(11)12)4-7(6)10(13)14/h4,8H,2-3H2,1H3 |
| InChIKey | PIITZSZVAUCFGQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine?
The IUPAC name of N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine (CID 163868016) is N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine.
What is the SMILES notation for N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine?
The canonical SMILES for N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine is CNC1=C([N+](=O)[O-])C=C([N+](=O)[O-])CC1.
What is the InChIKey of N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine?
The InChIKey is PIITZSZVAUCFGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O4/c1-8-6-3-2-5(9(11)12)4-7(6)10(13)14/h4,8H,2-3H2,1H3.
What are the key properties of N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine?
N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine has a molecular weight of 199.17 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine is sourced from PubChem (CID 163868016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).