C7H9N3O4 — CID 163868016
N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine (PubChem CID 163868016) has the molecular formula C7H9N3O4 and a molecular weight of 199.17 g/mol. Its IUPAC name is N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine.
| Compound Name | N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163868016 |
| Molecular Formula | C7H9N3O4 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | N-methyl-2,4-dinitrocyclohexa-1,3-dien-1-amine |
| SMILES | CNC1=C([N+](=O)[O-])C=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C7H9N3O4/c1-8-6-3-2-5(9(11)12)4-7(6)10(13)14/h4,8H,2-3H2,1H3 |
| InChIKey | PIITZSZVAUCFGQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 98.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|