About N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine
N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine (PubChem CID 118311568) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine.
Molecular Properties
| Compound Name | N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine |
| PubChem CID | 118311568 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine |
| SMILES | CNCC1=CC=C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C7H10N2O2/c1-8-5-6-2-3-7(4-6)9(10)11/h2-3,8H,4-5H2,1H3 |
| InChIKey | GGLDHAPDHLPAFW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine?
The IUPAC name of N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine (CID 118311568) is N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine.
What is the SMILES notation for N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine?
The canonical SMILES for N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine is CNCC1=CC=C([N+](=O)[O-])C1.
What is the InChIKey of N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine?
The InChIKey is GGLDHAPDHLPAFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-8-5-6-2-3-7(4-6)9(10)11/h2-3,8H,4-5H2,1H3.
What are the key properties of N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine?
N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine has a molecular weight of 154.17 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine is sourced from PubChem (CID 118311568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).