C7H10N2O2 — CID 118311568
N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine (PubChem CID 118311568) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine.
| Compound Name | N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine |
|---|---|
| PubChem CID | 118311568 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | N-methyl-1-(4-nitrocyclopenta-1,3-dien-1-yl)methanamine |
| SMILES | CNCC1=CC=C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C7H10N2O2/c1-8-5-6-2-3-7(4-6)9(10)11/h2-3,8H,4-5H2,1H3 |
| InChIKey | GGLDHAPDHLPAFW-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|