C6H4N3O4S+ — CID 22177507
4-nitro-6-sulfonylcyclohexa-1,3-diene-1-diazonium (PubChem CID 22177507) has the molecular formula C6H4N3O4S+ and a molecular weight of 214.18 g/mol. Its IUPAC name is 4-nitro-6-sulfonylcyclohexa-1,3-diene-1-diazonium.
| Compound Name | 4-nitro-6-sulfonylcyclohexa-1,3-diene-1-diazonium |
|---|---|
| PubChem CID | 22177507 |
| Molecular Formula | C6H4N3O4S+ |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 4-nitro-6-sulfonylcyclohexa-1,3-diene-1-diazonium |
| SMILES | N#[N+]C1=CC=C([N+](=O)[O-])CC1=S(=O)=O |
| InChI | InChI=1S/C6H4N3O4S/c7-8-5-2-1-4(9(10)11)3-6(5)14(12)13/h1-2H,3H2/q+1 |
| InChIKey | CPGJZKYNVDNEPB-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|