C14H17NO6 — CID 158468710
methanol;4-methoxycyclopenta-1,3-diene-1-carbaldehyde;4-nitrocyclopenta-1,3-diene-1-carbaldehyde (PubChem CID 158468710) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is methanol;4-methoxycyclopenta-1,3-diene-1-carbaldehyde;4-nitrocyclopenta-1,3-diene-1-carbaldehyde.
| Compound Name | methanol;4-methoxycyclopenta-1,3-diene-1-carbaldehyde;4-nitrocyclopenta-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 158468710 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | methanol;4-methoxycyclopenta-1,3-diene-1-carbaldehyde;4-nitrocyclopenta-1,3-diene-1-carbaldehyde |
| SMILES | CO.COC1=CC=C(C=O)C1.O=CC1=CC=C([N+](=O)[O-])C1 |
| InChI | InChI=1S/C7H8O2.C6H5NO3.CH4O/c1-9-7-3-2-6(4-7)5-8;8-4-5-1-2-6(3-5)7(9)10;1-2/h2-3,5H,4H2,1H3;1-2,4H,3H2;2H,1H3 |
| InChIKey | HGBSQRBBWREBQS-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|