C9H14N2O4S — CID 163604247
N,1,2-trimethyl-5-nitrocyclohexa-2,4-diene-1-sulfonamide (PubChem CID 163604247) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is N,1,2-trimethyl-5-nitrocyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | N,1,2-trimethyl-5-nitrocyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 163604247 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | N,1,2-trimethyl-5-nitrocyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CNS(=O)(=O)C1(C)CC([N+](=O)[O-])=CC=C1C |
| InChI | InChI=1S/C9H14N2O4S/c1-7-4-5-8(11(12)13)6-9(7,2)16(14,15)10-3/h4-5,10H,6H2,1-3H3 |
| InChIKey | HAJRZGYAHXUABI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|