C8H11FN2O4 — CID 163806189
4-fluoro-4,5-dimethyl-1,5-dinitrocyclohexene (PubChem CID 163806189) has the molecular formula C8H11FN2O4 and a molecular weight of 218.18 g/mol. Its IUPAC name is 4-fluoro-4,5-dimethyl-1,5-dinitrocyclohexene.
| Compound Name | 4-fluoro-4,5-dimethyl-1,5-dinitrocyclohexene |
|---|---|
| PubChem CID | 163806189 |
| Molecular Formula | C8H11FN2O4 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 4-fluoro-4,5-dimethyl-1,5-dinitrocyclohexene |
| SMILES | CC1(F)CC=C([N+](=O)[O-])CC1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H11FN2O4/c1-7(9)4-3-6(10(12)13)5-8(7,2)11(14)15/h3H,4-5H2,1-2H3 |
| InChIKey | NJFZBHCTVKKPJF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|