C7H8N2O5 — CID 87593431
6-methyl-2,6-dinitrocyclohexa-1,3-dien-1-ol (PubChem CID 87593431) has the molecular formula C7H8N2O5 and a molecular weight of 200.15 g/mol. Its IUPAC name is 6-methyl-2,6-dinitrocyclohexa-1,3-dien-1-ol.
| Compound Name | 6-methyl-2,6-dinitrocyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 87593431 |
| Molecular Formula | C7H8N2O5 |
| Molecular Weight | 200.15 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 6-methyl-2,6-dinitrocyclohexa-1,3-dien-1-ol |
| SMILES | CC1([N+](=O)[O-])CC=CC([N+](=O)[O-])=C1O |
| InChI | InChI=1S/C7H8N2O5/c1-7(9(13)14)4-2-3-5(6(7)10)8(11)12/h2-3,10H,4H2,1H3 |
| InChIKey | PZUZHELUVKNFQQ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.15 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|