C9H13NO3 — CID 78069449
3,5,5-trimethyl-2-nitrocyclohexa-1,3-dien-1-ol (PubChem CID 78069449) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3,5,5-trimethyl-2-nitrocyclohexa-1,3-dien-1-ol.
| Compound Name | 3,5,5-trimethyl-2-nitrocyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 78069449 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 3,5,5-trimethyl-2-nitrocyclohexa-1,3-dien-1-ol |
| SMILES | CC1=CC(C)(C)CC(O)=C1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13NO3/c1-6-4-9(2,3)5-7(11)8(6)10(12)13/h4,11H,5H2,1-3H3 |
| InChIKey | RRDAEGHJTZNHKZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|