C12H17NO3 — CID 13291681
4-tert-butyl-2,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one (PubChem CID 13291681) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 4-tert-butyl-2,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one.
| Compound Name | 4-tert-butyl-2,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 13291681 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-tert-butyl-2,6-dimethyl-4-nitrocyclohexa-2,5-dien-1-one |
| SMILES | CC1=CC([N+](=O)[O-])(C(C)(C)C)C=C(C)C1=O |
| InChI | InChI=1S/C12H17NO3/c1-8-6-12(13(15)16,11(3,4)5)7-9(2)10(8)14/h6-7H,1-5H3 |
| InChIKey | LSUVUZBBPLKWQD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|